What is the Bis(4-methylphenyl)iodonium hexafluorophosphate?

Bis(4-methylphenyl)iodonium hexafluorophosphate is White powder, while it's Molecular Formula is C14H14I . F6P. White powder Used in Chemical Synthesis: Bis(4-methylphenyl)iodonium hexafluorophosphate is used as a reagent in chemical synthesis for its ability to facilitate specific reactions and improve the yield of desired products. Its unique structure allows it to participate in various chemical transformations, making it a valuable tool in the synthesis of complex organic molecules. Used in Photochemistry: In the field of photochemistry, Bis(4-methylphenyl)iodonium hexafluorophosphate is used as a photosensitizer for its strong UV absorption peak at 267nm. This property enables it to absorb light and initiate photochemical reactions, which can be useful in the synthesis of various compounds and materials. Used in Electrochemistry: Bis(4-methylphenyl)iodonium hexafluorophosphate is used as an electrolyte in electrochemical applications due to its ability to conduct ions and facilitate charge transfer. Its use in this field can enhance the performance of electrochemical devices, such as batteries and fuel cells. Used in Analytical Chemistry: As an analytical reagent, Bis(4-methylphenyl)iodonium hexafluorophosphate is used for the detection and quantification of specific substances in various samples. Its unique UV absorption properties make it a useful tool for spectroscopic analysis and other analytical techniques. Used in Pharmaceutical Industry: In the pharmaceutical industry, Bis(4-methylphenyl)iodonium hexafluorophosphate is used as an intermediate in the synthesis of various drugs and drug candidates. Its unique chemical properties allow it to be a key component in the development of new medications with potential therapeutic applications. Used in Material Science: In material science, Bis(4-methylphenyl)iodonium hexafluorophosphate is used in the development of novel materials with specific properties. Its unique structure and reactivity can contribute to the creation of advanced materials with applications in various industries, such as electronics, aerospace, and energy.

What is the CAS number for Bis(4-methylphenyl)iodonium hexafluorophosphate?

The CAS number of Bis(4-methylphenyl)iodonium hexafluorophosphate is 60565-88-0.

What is Bis(4-methylphenyl)iodonium hexafluorophosphate (60565-88-0) used for?

Bis(4-methylphenyl)iodonium hexafluorophosphate is a white powder with a melting point of 175-180 °C and an UV absorption peak at 267nm. It is a type of iodonium salt that is often used in various chemical reactions and applications due to its unique properties.InChI:InChI=1/C14H14I.F6P/c1-11-3-7-13(8-4-11)15-14-9-5-12(2)6-10-14;1-7(2,3,4,5)6/h3-10H,1-2H3;/q+1;-1

What is the Bis(4-methylphenyl)iodonium hexafluorophosphate?

Bis(4-methylphenyl)iodonium hexafluorophosphate is White powder, while it's Molecular Formula is C14H14I . F6P. White powder Used in Chemical Synthesis: Bis(4-methylphenyl)iodonium hexafluorophosphate is used as a reagent in chemical synthesis for its ability to facilitate specific reactions and improve the yield of desired products. Its unique structure allows it to participate in various chemical transformations, making it a valuable tool in the synthesis of complex organic molecules. Used in Photochemistry: In the field of photochemistry, Bis(4-methylphenyl)iodonium hexafluorophosphate is used as a photosensitizer for its strong UV absorption peak at 267nm. This property enables it to absorb light and initiate photochemical reactions, which can be useful in the synthesis of various compounds and materials. Used in Electrochemistry: Bis(4-methylphenyl)iodonium hexafluorophosphate is used as an electrolyte in electrochemical applications due to its ability to conduct ions and facilitate charge transfer. Its use in this field can enhance the performance of electrochemical devices, such as batteries and fuel cells. Used in Analytical Chemistry: As an analytical reagent, Bis(4-methylphenyl)iodonium hexafluorophosphate is used for the detection and quantification of specific substances in various samples. Its unique UV absorption properties make it a useful tool for spectroscopic analysis and other analytical techniques. Used in Pharmaceutical Industry: In the pharmaceutical industry, Bis(4-methylphenyl)iodonium hexafluorophosphate is used as an intermediate in the synthesis of various drugs and drug candidates. Its unique chemical properties allow it to be a key component in the development of new medications with potential therapeutic applications. Used in Material Science: In material science, Bis(4-methylphenyl)iodonium hexafluorophosphate is used in the development of novel materials with specific properties. Its unique structure and reactivity can contribute to the creation of advanced materials with applications in various industries, such as electronics, aerospace, and energy.

What is the CAS number for Bis(4-methylphenyl)iodonium hexafluorophosphate?

The CAS number of Bis(4-methylphenyl)iodonium hexafluorophosphate is 60565-88-0.

What is Bis(4-methylphenyl)iodonium hexafluorophosphate (60565-88-0) used for?

Bis(4-methylphenyl)iodonium hexafluorophosphate is a white powder with a melting point of 175-180 °C and an UV absorption peak at 267nm. It is a type of iodonium salt that is often used in various chemical reactions and applications due to its unique properties.InChI:InChI=1/C14H14I.F6P/c1-11-3-7-13(8-4-11)15-14-9-5-12(2)6-10-14;1-7(2,3,4,5)6/h3-10H,1-2H3;/q+1;-1